Products 2167489-63-4

CAS 2167489-63-4 is the registry number for 3-Fluoro-1-methyl-1H-pyrrole-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-fluoro-1-methylpyrrole-2-carboxylic acid (CAS 2167489-63-4) is a chemical compound with the molecular formula C6H6FNO2 and a molecular weight of 143.12 g/mol. IUPAC name: 3-fluoro-1-methylpyrrole-2-carboxylic acid. InChIKey: QBAUEHVLEYAIQN-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6FNO2
Molecular weight143.12 g/mol
IUPAC name3-fluoro-1-methylpyrrole-2-carboxylic acid
InChIKeyQBAUEHVLEYAIQN-UHFFFAOYSA-N
SMILESCN1C=CC(=C1C(=O)O)F

Computed by PubChem (NCBI)