Products 2471973-24-5

CAS 2471973-24-5 is the registry number for rel-(1R,3r)-3-cyano-3-fluorocyclobutane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-cyano-3-fluorocyclobutane-1-carboxylic acid (CAS 2471973-24-5) is a chemical compound with the molecular formula C6H6FNO2 and a molecular weight of 143.12 g/mol. IUPAC name: 3-cyano-3-fluorocyclobutane-1-carboxylic acid. InChIKey: OBWFMCVDZGGJNO-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6FNO2
Molecular weight143.12 g/mol
IUPAC name3-cyano-3-fluorocyclobutane-1-carboxylic acid
InChIKeyOBWFMCVDZGGJNO-UHFFFAOYSA-N
SMILESC1C(CC1(C#N)F)C(=O)O

Computed by PubChem (NCBI)