Products 21675-47-8
CAS 21675-47-8 appears in our catalog under these names: Ascorbic Acid Impurity 10(D-xylo-2-Hexulosonic acid), Ascorbic Acid Impurity 4 (D-xylo-2-Hexulosonic acid), Ascorbic Acid Impurity 3（D-sorbosonic acid）. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(3R,4S,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoic acid (CAS 21675-47-8) is a chemical compound with the molecular formula C6H10O7 and a molecular weight of 194.14 g/mol. IUPAC name: (3R,4S,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoic acid. InChIKey: VBUYCZFBVCCYFD-FLRLBIABSA-N.
| Molecular formula | C6H10O7 |
|---|---|
| Molecular weight | 194.14 g/mol |
| IUPAC name | (3R,4S,5R)-3,4,5,6-tetrahydroxy-2-oxohexanoic acid |
| InChIKey | VBUYCZFBVCCYFD-FLRLBIABSA-N |
| SMILES | C([C@H]([C@@H]([C@H](C(=O)C(=O)O)O)O)O)O |
Computed by PubChem (NCBI)