CAS 2167857-15-8 is the registry number for tert-Butyl 3-hydroxy-3-(oxazol-5-yl)pyrrolidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-hydroxy-3-(1,3-oxazol-5-yl)pyrrolidine-1-carboxylate (CAS 2167857-15-8) is a chemical compound with the molecular formula C12H18N2O4 and a molecular weight of 254.28 g/mol. IUPAC name: tert-butyl 3-hydroxy-3-(1,3-oxazol-5-yl)pyrrolidine-1-carboxylate. InChIKey: QLICFJZCGZZGJW-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O4 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | tert-butyl 3-hydroxy-3-(1,3-oxazol-5-yl)pyrrolidine-1-carboxylate |
| InChIKey | QLICFJZCGZZGJW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)(C2=CN=CO2)O |
Computed by PubChem (NCBI)