Products 2167875-99-0

CAS 2167875-99-0 is the registry number for Ethyl 2-(4-amino-2,3-dimethylphenyl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 2-(4-amino-2,3-dimethylphenyl)acetate (CAS 2167875-99-0) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: ethyl 2-(4-amino-2,3-dimethylphenyl)acetate. InChIKey: AIZCGHMFHYQAJY-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17NO2
Molecular weight207.27 g/mol
IUPAC nameethyl 2-(4-amino-2,3-dimethylphenyl)acetate
InChIKeyAIZCGHMFHYQAJY-UHFFFAOYSA-N
SMILESCCOC(=O)CC1=C(C(=C(C=C1)N)C)C

Computed by PubChem (NCBI)