CAS 2167875-99-0 is the registry number for Ethyl 2-(4-amino-2,3-dimethylphenyl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(4-amino-2,3-dimethylphenyl)acetate (CAS 2167875-99-0) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: ethyl 2-(4-amino-2,3-dimethylphenyl)acetate. InChIKey: AIZCGHMFHYQAJY-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | ethyl 2-(4-amino-2,3-dimethylphenyl)acetate |
| InChIKey | AIZCGHMFHYQAJY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=C(C(=C(C=C1)N)C)C |
Computed by PubChem (NCBI)