Products 2168828-19-9
CAS 2168828-19-9 is the registry number for 4-Amino-α,α-dimethyl-2-(trifluoromethyl)benzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-[4-amino-2-(trifluoromethyl)phenyl]propan-2-ol (CAS 2168828-19-9) is a chemical compound with the molecular formula C10H12F3NO and a molecular weight of 219.20 g/mol. IUPAC name: 2-[4-amino-2-(trifluoromethyl)phenyl]propan-2-ol. InChIKey: ZZOGMTFADMICDF-UHFFFAOYSA-N.
| Molecular formula | C10H12F3NO |
|---|---|
| Molecular weight | 219.20 g/mol |
| IUPAC name | 2-[4-amino-2-(trifluoromethyl)phenyl]propan-2-ol |
| InChIKey | ZZOGMTFADMICDF-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=C(C=C(C=C1)N)C(F)(F)F)O |
Computed by PubChem (NCBI)