Products 2169013-73-2
CAS 2169013-73-2 is the registry number for 2-(4-Chlorophenyl)-5,8-dioxaspiro[3.4]octan-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-chlorophenyl)-5,8-dioxaspiro[3.4]octan-2-amine (CAS 2169013-73-2) is a chemical compound with the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. IUPAC name: 2-(4-chlorophenyl)-5,8-dioxaspiro[3.4]octan-2-amine. InChIKey: WPZNHDRIELGEJE-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO2 |
|---|---|
| Molecular weight | 239.70 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-5,8-dioxaspiro[3.4]octan-2-amine |
| InChIKey | WPZNHDRIELGEJE-UHFFFAOYSA-N |
| SMILES | C1COC2(O1)CC(C2)(C3=CC=C(C=C3)Cl)N |
Computed by PubChem (NCBI)