CAS 2169190-24-1 is the registry number for 3-(Propan-2-yl)-1-(pyridin-4-yl)-1H-1,2,4-triazol-5-ol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-propan-2-yl-2-pyridin-4-yl-4H-1,2,4-triazol-3-one (CAS 2169190-24-1) is a chemical compound with the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. IUPAC name: 5-propan-2-yl-2-pyridin-4-yl-4H-1,2,4-triazol-3-one. InChIKey: ZYZXOECZLDUKMH-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O |
|---|---|
| Molecular weight | 204.23 g/mol |
| IUPAC name | 5-propan-2-yl-2-pyridin-4-yl-4H-1,2,4-triazol-3-one |
| InChIKey | ZYZXOECZLDUKMH-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NN(C(=O)N1)C2=CC=NC=C2 |
Computed by PubChem (NCBI)