Products 2169247-39-4
CAS 2169247-39-4 appears in our catalog under these names: Vardenafil EP Impurity A, 2-(2-Ethoxy-5-((4-ethylpiperazin-1-yl)sulfonyl)phenyl)-5,7-dimethylimidazo[5,1-f][1,2,4]triazin-4(1H)-one 98%, Vardenafil EP impurity A, 98%, 98%. Offered by: Chemat Brand, Ambeed, Chemat. Available pack sizes: on request, 25mg, 50mg, 100mg, 250mg.
2-[2-ethoxy-5-(4-ethylpiperazin-1-yl)sulfonylphenyl]-5,7-dimethyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one (CAS 2169247-39-4) is a chemical compound with the molecular formula C21H28N6O4S and a molecular weight of 460.6 g/mol. IUPAC name: 2-[2-ethoxy-5-(4-ethylpiperazin-1-yl)sulfonylphenyl]-5,7-dimethyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one. InChIKey: NUTCCLZNRHZTGU-UHFFFAOYSA-N.
| Molecular formula | C21H28N6O4S |
|---|---|
| Molecular weight | 460.6 g/mol |
| IUPAC name | 2-[2-ethoxy-5-(4-ethylpiperazin-1-yl)sulfonylphenyl]-5,7-dimethyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one |
| InChIKey | NUTCCLZNRHZTGU-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CC1)S(=O)(=O)C2=CC(=C(C=C2)OCC)C3=NN4C(=NC(=C4C(=O)N3)C)C |
Computed by PubChem (NCBI)
Synonyms:
Vardenafil EP impurity A, 7-Methyl vardenafil, Vardenafil, 7-methyl, 7-Despropyl 7-Methyl Vardenafil, 7-Methyl vardenafil [USP], Vardenafil hydrochloride trihydrate impurity A [EP], Vardenafil hydrochloride trihydrate EP Impurity A, VARDENAFIL HYDROCHLORIDE TRIHYDRATE IMPURITY A [EP IMPURITY]