Products 2834736-82-0

CAS 2834736-82-0 is the registry number for SIRT5 inhibitor 6. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg, 100 mg, 50 mg, 25 mg, 10 mg.

Structural formula: {0} (CAS {1})

3-[3-[[2-(benzylamino)-5-ethoxycarbonylpyrimidin-4-yl]amino]propylcarbamothioylamino]propanoic acid (CAS 2834736-82-0) is a chemical compound with the molecular formula C21H28N6O4S and a molecular weight of 460.6 g/mol. IUPAC name: 3-[3-[[2-(benzylamino)-5-ethoxycarbonylpyrimidin-4-yl]amino]propylcarbamothioylamino]propanoic acid. InChIKey: CEAPZJWXJWNRMC-UHFFFAOYSA-N.

Identity
Molecular formulaC21H28N6O4S
Molecular weight460.6 g/mol
IUPAC name3-[3-[[2-(benzylamino)-5-ethoxycarbonylpyrimidin-4-yl]amino]propylcarbamothioylamino]propanoic acid
InChIKeyCEAPZJWXJWNRMC-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CN=C(N=C1NCCCNC(=S)NCCC(=O)O)NCC2=CC=CC=C2

Computed by PubChem (NCBI)

Synonyms: orb1944442