Products 2169369-13-3
CAS 2169369-13-3 is the registry number for 1-bromo-2-chloro-3-fluoro-5-(trifluoromethyl)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-2-chloro-3-fluoro-5-(trifluoromethyl)benzene (CAS 2169369-13-3) is a chemical compound with the molecular formula C7H2BrClF4 and a molecular weight of 277.44 g/mol. IUPAC name: 1-bromo-2-chloro-3-fluoro-5-(trifluoromethyl)benzene. InChIKey: YCMRITBXMWVHTC-UHFFFAOYSA-N.
| Molecular formula | C7H2BrClF4 |
|---|---|
| Molecular weight | 277.44 g/mol |
| IUPAC name | 1-bromo-2-chloro-3-fluoro-5-(trifluoromethyl)benzene |
| InChIKey | YCMRITBXMWVHTC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)Cl)Br)C(F)(F)F |
Computed by PubChem (NCBI)