CAS 2169699-38-9 is the registry number for Ethyl 2-((1H-pyrrolo[2,3-b]pyridin-5-yl)oxy)-4-fluorobenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 4-fluoro-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoate (CAS 2169699-38-9) is a chemical compound with the molecular formula C16H13FN2O3 and a molecular weight of 300.28 g/mol. IUPAC name: ethyl 4-fluoro-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoate. InChIKey: JDPFQUBAETUTAZ-UHFFFAOYSA-N.
| Molecular formula | C16H13FN2O3 |
|---|---|
| Molecular weight | 300.28 g/mol |
| IUPAC name | ethyl 4-fluoro-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoate |
| InChIKey | JDPFQUBAETUTAZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1)F)OC2=CN=C3C(=C2)C=CN3 |
Computed by PubChem (NCBI)