Products 297147-95-6
CAS 297147-95-6 is the registry number for 4-(4-(4-Fluorophenoxy)-5-methyl-1H-pyrazol-3-yl)benzene-1,3-diol, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-(4-fluorophenoxy)-5-methyl-1H-pyrazol-3-yl]benzene-1,3-diol (CAS 297147-95-6) is a chemical compound with the molecular formula C16H13FN2O3 and a molecular weight of 300.28 g/mol. IUPAC name: 4-[4-(4-fluorophenoxy)-5-methyl-1H-pyrazol-3-yl]benzene-1,3-diol. InChIKey: GJKRGPNMAMNZDR-UHFFFAOYSA-N.
| Molecular formula | C16H13FN2O3 |
|---|---|
| Molecular weight | 300.28 g/mol |
| IUPAC name | 4-[4-(4-fluorophenoxy)-5-methyl-1H-pyrazol-3-yl]benzene-1,3-diol |
| InChIKey | GJKRGPNMAMNZDR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C2=C(C=C(C=C2)O)O)OC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)