Products 21698-41-9
CAS 21698-41-9 is the registry number for Pogostol. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 100mg, 50mg.
(1R,3aS,4R,7S,8aR)-1,4-dimethyl-7-prop-1-en-2-yl-2,3,3a,5,6,7,8,8a-octahydro-1H-azulen-4-ol (CAS 21698-41-9) is a chemical compound with the molecular formula C15H26O and a molecular weight of 222.37 g/mol. IUPAC name: (1R,3aS,4R,7S,8aR)-1,4-dimethyl-7-prop-1-en-2-yl-2,3,3a,5,6,7,8,8a-octahydro-1H-azulen-4-ol. InChIKey: VYOZKWKETGHHDW-QKGCVVFFSA-N.
| Molecular formula | C15H26O |
|---|---|
| Molecular weight | 222.37 g/mol |
| IUPAC name | (1R,3aS,4R,7S,8aR)-1,4-dimethyl-7-prop-1-en-2-yl-2,3,3a,5,6,7,8,8a-octahydro-1H-azulen-4-ol |
| InChIKey | VYOZKWKETGHHDW-QKGCVVFFSA-N |
| SMILES | C[C@@H]1CC[C@H]2[C@@H]1C[C@H](CC[C@@]2(C)O)C(=C)C |
Computed by PubChem (NCBI)