CAS 216983-03-8 is the registry number for 2,4,7-Trimethyldibenzothiophene, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg.
2,4,7-trimethyldibenzothiophene (CAS 216983-03-8) is a chemical compound with the molecular formula C15H14S and a molecular weight of 226.3 g/mol. IUPAC name: 2,4,7-trimethyldibenzothiophene. InChIKey: YDWNRDFOOADVGC-UHFFFAOYSA-N.
| Molecular formula | C15H14S |
|---|---|
| Molecular weight | 226.3 g/mol |
| IUPAC name | 2,4,7-trimethyldibenzothiophene |
| InChIKey | YDWNRDFOOADVGC-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C3=CC(=CC(=C3S2)C)C |
Computed by PubChem (NCBI)