CAS 345306-43-6 appears in our catalog under these names: 2,5-Dimethyl-3-phenyl-6h-cyclopenta[b]thiophene, 95%, 6H–Cyclopenta(b)thiophene, 2,5–dimethyl–3–phenyl–, 2,5-DIMETHYL-3-PHENYL-6H-CYCLOPENTA[B]THIOPHENE, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 100mg.
2,5-dimethyl-3-phenyl-6H-cyclopenta[b]thiophene (CAS 345306-43-6) is a chemical compound with the molecular formula C15H14S and a molecular weight of 226.3 g/mol. IUPAC name: 2,5-dimethyl-3-phenyl-6H-cyclopenta[b]thiophene. InChIKey: NXGVKVNLLSSVQQ-UHFFFAOYSA-N.
| Molecular formula | C15H14S |
|---|---|
| Molecular weight | 226.3 g/mol |
| IUPAC name | 2,5-dimethyl-3-phenyl-6H-cyclopenta[b]thiophene |
| InChIKey | NXGVKVNLLSSVQQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C1)SC(=C2C3=CC=CC=C3)C |
Computed by PubChem (NCBI)