CAS 217-82-3 appears in our catalog under these names: Pyrazino(2,3-f)(4,7)phenanthroline, Pyrazino[2,3-f][4,7]phenanthroline, Pyrazino[2,3-f][4,7]phenanthroline, 98%. Offered by: TRC, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Pyrazino[2,3-f][4,7]phenanthroline (CAS 217-82-3) is a chemical compound with the molecular formula C14H8N4 and a molecular weight of 232.24 g/mol. IUPAC name: pyrazino[2,3-f][4,7]phenanthroline. InChIKey: NVFJXZGVAGNQDD-UHFFFAOYSA-N.
| Molecular formula | C14H8N4 |
|---|---|
| Molecular weight | 232.24 g/mol |
| IUPAC name | pyrazino[2,3-f][4,7]phenanthroline |
| InChIKey | NVFJXZGVAGNQDD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=NC=CN=C3C4=C2C=CC=N4)N=C1 |
Computed by PubChem (NCBI)