CAS 217-90-3 appears in our catalog under these names: Pyrazino[2,3-f][1,10]phenanthroline 95%, PYRAZINO[2,3-F][1,10]PHENANTHROLINE, 99&, Pyrazino[2,3-f][1,10]phenanthroline, 95%, 95%, Pyrazino[2,3-f][1,10]phenanthroline, 95%. Offered by: Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
Pyrazino[2,3-f][1,10]phenanthroline (CAS 217-90-3) is a chemical compound with the molecular formula C14H8N4 and a molecular weight of 232.24 g/mol. IUPAC name: pyrazino[2,3-f][1,10]phenanthroline. InChIKey: IBOSPAWVGHGUAV-UHFFFAOYSA-N.
| Molecular formula | C14H8N4 |
|---|---|
| Molecular weight | 232.24 g/mol |
| IUPAC name | pyrazino[2,3-f][1,10]phenanthroline |
| InChIKey | IBOSPAWVGHGUAV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C(C=CC=N3)C4=NC=CN=C24)N=C1 |
Computed by PubChem (NCBI)