CAS 2170136-02-2 appears in our catalog under these names: 2-((3,5-Dicyano-6-(dimethylamino)-4-ethylpyridin-2-yl)thio)-2-phenylacetamide, 98%, 98%, (Rac)–GSK–3484862, (Rac)-GSK-3484862, 99.43%, (Rac)-GSK-3484862, 99%. Offered by: Chemat, GLPBio, MedChemExpress, Fluorochem. Available pack sizes: 10mg, 1mg, 5mg, 1 mg, 10 mg, 5 mg.
2-[[3,5-dicyano-6-(dimethylamino)-4-ethyl-2-pyridinyl]sulfanyl]-2-phenylacetamide (CAS 2170136-02-2) is a chemical compound with the molecular formula C19H19N5OS and a molecular weight of 365.5 g/mol. IUPAC name: 2-[[3,5-dicyano-6-(dimethylamino)-4-ethyl-2-pyridinyl]sulfanyl]-2-phenylacetamide. InChIKey: KIEQQZZDWUNUQK-UHFFFAOYSA-N.
| Molecular formula | C19H19N5OS |
|---|---|
| Molecular weight | 365.5 g/mol |
| IUPAC name | 2-[[3,5-dicyano-6-(dimethylamino)-4-ethyl-2-pyridinyl]sulfanyl]-2-phenylacetamide |
| InChIKey | KIEQQZZDWUNUQK-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=NC(=C1C#N)SC(C2=CC=CC=C2)C(=O)N)N(C)C)C#N |
Computed by PubChem (NCBI)