Products 2170136-65-7
CAS 2170136-65-7 appears in our catalog under these names: GSK-3484862/ 100%, GSK–3484862, (R)-2-((3,5-Dicyano-6-(dimethylamino)-4-ethylpyridin-2-yl)thio)-2-phenylacetamide, GSK-3484862, 99.95%, GSK-3484862, 98%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress, Ambeed. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 5 mg.
(2R)-2-[[3,5-dicyano-6-(dimethylamino)-4-ethyl-2-pyridinyl]sulfanyl]-2-phenylacetamide (CAS 2170136-65-7) is a chemical compound with the molecular formula C19H19N5OS and a molecular weight of 365.5 g/mol. IUPAC name: (2R)-2-[[3,5-dicyano-6-(dimethylamino)-4-ethyl-2-pyridinyl]sulfanyl]-2-phenylacetamide. InChIKey: KIEQQZZDWUNUQK-MRXNPFEDSA-N.
| Molecular formula | C19H19N5OS |
|---|---|
| Molecular weight | 365.5 g/mol |
| IUPAC name | (2R)-2-[[3,5-dicyano-6-(dimethylamino)-4-ethyl-2-pyridinyl]sulfanyl]-2-phenylacetamide |
| InChIKey | KIEQQZZDWUNUQK-MRXNPFEDSA-N |
| SMILES | CCC1=C(C(=NC(=C1C#N)S[C@H](C2=CC=CC=C2)C(=O)N)N(C)C)C#N |
Computed by PubChem (NCBI)