CAS 2170210-92-9 is the registry number for Methyl (S)-2'-oxo-1,3-dihydrospiro[indene-2,3'-pyrrolidine]-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-2'-oxospiro[1,3-dihydroindene-2,3'-pyrrolidine]-5-carboxylate (CAS 2170210-92-9) is a chemical compound with the molecular formula C14H15NO3 and a molecular weight of 245.27 g/mol. IUPAC name: methyl (2S)-2'-oxospiro[1,3-dihydroindene-2,3'-pyrrolidine]-5-carboxylate. InChIKey: DQDUSCFZFATBFJ-AWEZNQCLSA-N.
| Molecular formula | C14H15NO3 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | methyl (2S)-2'-oxospiro[1,3-dihydroindene-2,3'-pyrrolidine]-5-carboxylate |
| InChIKey | DQDUSCFZFATBFJ-AWEZNQCLSA-N |
| SMILES | COC(=O)C1=CC2=C(C[C@]3(C2)CCNC3=O)C=C1 |
Computed by PubChem (NCBI)