Products 2170372-49-1
CAS 2170372-49-1 is the registry number for 1-(Difluoromethyl)-2-oxabicyclo(2.2.2)octan-4-amine hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
1-(difluoromethyl)-2-oxabicyclo[2.2.2]octan-4-amine;hydrochloride (CAS 2170372-49-1) is a chemical compound with the molecular formula C8H14ClF2NO and a molecular weight of 213.65 g/mol. IUPAC name: 1-(difluoromethyl)-2-oxabicyclo[2.2.2]octan-4-amine;hydrochloride. InChIKey: DPIQNLDVGAFQIX-UHFFFAOYSA-N.
| Molecular formula | C8H14ClF2NO |
|---|---|
| Molecular weight | 213.65 g/mol |
| IUPAC name | 1-(difluoromethyl)-2-oxabicyclo[2.2.2]octan-4-amine;hydrochloride |
| InChIKey | DPIQNLDVGAFQIX-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC1(CO2)N)C(F)F.Cl |
Computed by PubChem (NCBI)