CAS 2418708-74-2 is the registry number for (2,2-Difluoro-6-oxaspiro(3.4)octan-7-yl)methanamine hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
(2,2-difluoro-6-oxaspiro[3.4]octan-7-yl)methanamine;hydrochloride (CAS 2418708-74-2) is a chemical compound with the molecular formula C8H14ClF2NO and a molecular weight of 213.65 g/mol. IUPAC name: (2,2-difluoro-6-oxaspiro[3.4]octan-7-yl)methanamine;hydrochloride. InChIKey: JUBRLAQCOXZWIL-UHFFFAOYSA-N.
| Molecular formula | C8H14ClF2NO |
|---|---|
| Molecular weight | 213.65 g/mol |
| IUPAC name | (2,2-difluoro-6-oxaspiro[3.4]octan-7-yl)methanamine;hydrochloride |
| InChIKey | JUBRLAQCOXZWIL-UHFFFAOYSA-N |
| SMILES | C1C(OCC12CC(C2)(F)F)CN.Cl |
Computed by PubChem (NCBI)