CAS 2170752-17-5 is the registry number for 3-Amino-5-isopropyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4(5H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-amino-5-propan-2-yl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one (CAS 2170752-17-5) is a chemical compound with the molecular formula C9H14N4O and a molecular weight of 194.23 g/mol. IUPAC name: 3-amino-5-propan-2-yl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one. InChIKey: SPMXLULYGIDOCW-UHFFFAOYSA-N.
| Molecular formula | C9H14N4O |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 3-amino-5-propan-2-yl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one |
| InChIKey | SPMXLULYGIDOCW-UHFFFAOYSA-N |
| SMILES | CC(C)N1CCN2C(=C(C=N2)N)C1=O |
Computed by PubChem (NCBI)