Products 303996-70-5
CAS 303996-70-5 is the registry number for (1E)-1-(Dimethylamino)-4-(1h-1,2,4-triazol-1-yl)pent-1-en-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(E)-1-(dimethylamino)-4-(1,2,4-triazol-1-yl)pent-1-en-3-one (CAS 303996-70-5) is a chemical compound with the molecular formula C9H14N4O and a molecular weight of 194.23 g/mol. IUPAC name: (E)-1-(dimethylamino)-4-(1,2,4-triazol-1-yl)pent-1-en-3-one. InChIKey: PCRSVQUKTRFGOK-SNAWJCMRSA-N.
| Molecular formula | C9H14N4O |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | (E)-1-(dimethylamino)-4-(1,2,4-triazol-1-yl)pent-1-en-3-one |
| InChIKey | PCRSVQUKTRFGOK-SNAWJCMRSA-N |
| SMILES | CC(C(=O)/C=C/N(C)C)N1C=NC=N1 |
Computed by PubChem (NCBI)