CAS 21708-28-1 appears in our catalog under these names: 2-[2-(6-Amino-9h-purin-9-yl)ethyl]-2,3-dihydro-1h-isoindole-1,3-dione, 95%, 2-(2-(6-Amino-9H-purin-9-yl)ethyl)-2,3-dihydro-1H-isoindole-1,3-dione, 95%, 2-(2-(6-Amino-9H-purin-9-yl)ethyl)-2,3-dihydro-1H-isoindole-1,3-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 5000mg, 1000mg.
2-[2-(6-aminopurin-9-yl)ethyl]isoindole-1,3-dione (CAS 21708-28-1) is a chemical compound with the molecular formula C15H12N6O2 and a molecular weight of 308.29 g/mol. IUPAC name: 2-[2-(6-aminopurin-9-yl)ethyl]isoindole-1,3-dione. InChIKey: XRMKGQLMYJAVJU-UHFFFAOYSA-N.
| Molecular formula | C15H12N6O2 |
|---|---|
| Molecular weight | 308.29 g/mol |
| IUPAC name | 2-[2-(6-aminopurin-9-yl)ethyl]isoindole-1,3-dione |
| InChIKey | XRMKGQLMYJAVJU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCN3C=NC4=C(N=CN=C43)N |
Computed by PubChem (NCBI)