CAS 78650-05-2 is the registry number for 1,4-Dihydro-4-(3-nitrophenyl)-1,3,5-triazino[1,2-a]benzimidazol-2-amine, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
4-(3-nitrophenyl)-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine (CAS 78650-05-2) is a chemical compound with the molecular formula C15H12N6O2 and a molecular weight of 308.29 g/mol. IUPAC name: 4-(3-nitrophenyl)-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine. InChIKey: MKPGPLNWEGNLML-UHFFFAOYSA-N.
| Molecular formula | C15H12N6O2 |
|---|---|
| Molecular weight | 308.29 g/mol |
| IUPAC name | 4-(3-nitrophenyl)-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine |
| InChIKey | MKPGPLNWEGNLML-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C3N2C(N=C(N3)N)C4=CC(=CC=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)