Products 2170816-89-2
CAS 2170816-89-2 is the registry number for (2S,4R)-4-Hydroxy-N-(2-methylnaphthalen-1-yl)pyrrolidine-2-carboxamide, 97%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(2S,4R)-4-hydroxy-N-(2-methylnaphthalen-1-yl)pyrrolidine-2-carboxamide (CAS 2170816-89-2) is a chemical compound with the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. IUPAC name: (2S,4R)-4-hydroxy-N-(2-methylnaphthalen-1-yl)pyrrolidine-2-carboxamide. InChIKey: RIFYYESNHDIPIS-OCCSQVGLSA-N.
| Molecular formula | C16H18N2O2 |
|---|---|
| Molecular weight | 270.33 g/mol |
| IUPAC name | (2S,4R)-4-hydroxy-N-(2-methylnaphthalen-1-yl)pyrrolidine-2-carboxamide |
| InChIKey | RIFYYESNHDIPIS-OCCSQVGLSA-N |
| SMILES | CC1=C(C2=CC=CC=C2C=C1)NC(=O)[C@@H]3C[C@H](CN3)O |
Computed by PubChem (NCBI)