CAS 217093-89-5 is the registry number for [trans-2-(aminomethyl)cyclopropyl]methanamine,dihydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
[(1R,2R)-2-(aminomethyl)cyclopropyl]methanamine;dihydrochloride (CAS 217093-89-5) is a chemical compound with the molecular formula C5H14Cl2N2 and a molecular weight of 173.08 g/mol. IUPAC name: [(1R,2R)-2-(aminomethyl)cyclopropyl]methanamine;dihydrochloride. InChIKey: CEFAWHWAKPTGEL-RSLHMRQOSA-N.
| Molecular formula | C5H14Cl2N2 |
|---|---|
| Molecular weight | 173.08 g/mol |
| IUPAC name | [(1R,2R)-2-(aminomethyl)cyclopropyl]methanamine;dihydrochloride |
| InChIKey | CEFAWHWAKPTGEL-RSLHMRQOSA-N |
| SMILES | C1[C@H]([C@@H]1CN)CN.Cl.Cl |
Computed by PubChem (NCBI)