CAS 2171169-82-5 is the registry number for rac-(1R,3S)-3-((tert-Butoxy)carbonyl)-1-methylcyclobutane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-methyl-3-[(2-methylpropan-2-yl)oxycarbonyl]cyclobutane-1-carboxylic acid (CAS 2171169-82-5) is a chemical compound with the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. IUPAC name: 1-methyl-3-[(2-methylpropan-2-yl)oxycarbonyl]cyclobutane-1-carboxylic acid. InChIKey: IFAGPUJTBGVORN-UHFFFAOYSA-N.
| Molecular formula | C11H18O4 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | 1-methyl-3-[(2-methylpropan-2-yl)oxycarbonyl]cyclobutane-1-carboxylic acid |
| InChIKey | IFAGPUJTBGVORN-UHFFFAOYSA-N |
| SMILES | CC1(CC(C1)C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)