Products 2171182-32-2

CAS 2171182-32-2 is the registry number for 2-((3R)-Oxolan-3-yloxy)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-[(3R)-oxolan-3-yl]oxyacetic acid (CAS 2171182-32-2) is a chemical compound with the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. IUPAC name: 2-[(3R)-oxolan-3-yl]oxyacetic acid. InChIKey: ZZEMYDVVPYLDBT-RXMQYKEDSA-N.

Identity
Molecular formulaC6H10O4
Molecular weight146.14 g/mol
IUPAC name2-[(3R)-oxolan-3-yl]oxyacetic acid
InChIKeyZZEMYDVVPYLDBT-RXMQYKEDSA-N
SMILESC1COC[C@@H]1OCC(=O)O

Computed by PubChem (NCBI)