Products 2171204-06-9
CAS 2171204-06-9 is the registry number for (1S)-2-Amino-1-(1-benzothiophen-2-yl)ethan-1-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1S)-2-amino-1-(1-benzothiophen-2-yl)ethanol;hydrochloride (CAS 2171204-06-9) is a chemical compound with the molecular formula C10H12ClNOS and a molecular weight of 229.73 g/mol. IUPAC name: (1S)-2-amino-1-(1-benzothiophen-2-yl)ethanol;hydrochloride. InChIKey: BPMVABYEQMZYQQ-QRPNPIFTSA-N.
| Molecular formula | C10H12ClNOS |
|---|---|
| Molecular weight | 229.73 g/mol |
| IUPAC name | (1S)-2-amino-1-(1-benzothiophen-2-yl)ethanol;hydrochloride |
| InChIKey | BPMVABYEQMZYQQ-QRPNPIFTSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(S2)[C@H](CN)O.Cl |
Computed by PubChem (NCBI)