CAS 217195-91-0 is the registry number for Ethyl 2-hydroxy-2-(trifluoromethyl)-4-methylpent-4-enoate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 1g, 5g.
Ethyl 2-hydroxy-4-methyl-2-(trifluoromethyl)pent-4-enoate (CAS 217195-91-0) is a chemical compound with the molecular formula C9H13F3O3 and a molecular weight of 226.19 g/mol. IUPAC name: ethyl 2-hydroxy-4-methyl-2-(trifluoromethyl)pent-4-enoate. InChIKey: OUJRZMYAWPFRSV-UHFFFAOYSA-N.
| Molecular formula | C9H13F3O3 |
|---|---|
| Molecular weight | 226.19 g/mol |
| IUPAC name | ethyl 2-hydroxy-4-methyl-2-(trifluoromethyl)pent-4-enoate |
| InChIKey | OUJRZMYAWPFRSV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC(=C)C)(C(F)(F)F)O |
Computed by PubChem (NCBI)