Products 502607-34-3

CAS 502607-34-3 is the registry number for 2-Cyclohexyl-3,3,3-trifluoro-2-hydroxypropanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-cyclohexyl-3,3,3-trifluoro-2-hydroxypropanoic acid (CAS 502607-34-3) is a chemical compound with the molecular formula C9H13F3O3 and a molecular weight of 226.19 g/mol. IUPAC name: 2-cyclohexyl-3,3,3-trifluoro-2-hydroxypropanoic acid. InChIKey: WNXJNXZOYHFFFN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13F3O3
Molecular weight226.19 g/mol
IUPAC name2-cyclohexyl-3,3,3-trifluoro-2-hydroxypropanoic acid
InChIKeyWNXJNXZOYHFFFN-UHFFFAOYSA-N
SMILESC1CCC(CC1)C(C(=O)O)(C(F)(F)F)O

Computed by PubChem (NCBI)