CAS 502607-34-3 is the registry number for 2-Cyclohexyl-3,3,3-trifluoro-2-hydroxypropanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-cyclohexyl-3,3,3-trifluoro-2-hydroxypropanoic acid (CAS 502607-34-3) is a chemical compound with the molecular formula C9H13F3O3 and a molecular weight of 226.19 g/mol. IUPAC name: 2-cyclohexyl-3,3,3-trifluoro-2-hydroxypropanoic acid. InChIKey: WNXJNXZOYHFFFN-UHFFFAOYSA-N.
| Molecular formula | C9H13F3O3 |
|---|---|
| Molecular weight | 226.19 g/mol |
| IUPAC name | 2-cyclohexyl-3,3,3-trifluoro-2-hydroxypropanoic acid |
| InChIKey | WNXJNXZOYHFFFN-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(C(=O)O)(C(F)(F)F)O |
Computed by PubChem (NCBI)