CAS 2171989-74-3 is the registry number for 1-Methyl-5-(piperazin-1-ylmethyl)-1H-pyrazole-4-carboxylic acid dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-methyl-5-(piperazin-1-ylmethyl)pyrazole-4-carboxylic acid;dihydrochloride (CAS 2171989-74-3) is a chemical compound with the molecular formula C10H18Cl2N4O2 and a molecular weight of 297.18 g/mol. IUPAC name: 1-methyl-5-(piperazin-1-ylmethyl)pyrazole-4-carboxylic acid;dihydrochloride. InChIKey: BEIUENROTZGJAO-UHFFFAOYSA-N.
| Molecular formula | C10H18Cl2N4O2 |
|---|---|
| Molecular weight | 297.18 g/mol |
| IUPAC name | 1-methyl-5-(piperazin-1-ylmethyl)pyrazole-4-carboxylic acid;dihydrochloride |
| InChIKey | BEIUENROTZGJAO-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)C(=O)O)CN2CCNCC2.Cl.Cl |
Computed by PubChem (NCBI)