CAS 2193064-78-5 is the registry number for 6-(4-Aminopiperidin-1-yl)-3-methyl-1,2,3,4-tetrahydropyrimidine-2,4-dione dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-(4-aminopiperidin-1-yl)-3-methyl-1H-pyrimidine-2,4-dione;dihydrochloride (CAS 2193064-78-5) is a chemical compound with the molecular formula C10H18Cl2N4O2 and a molecular weight of 297.18 g/mol. IUPAC name: 6-(4-aminopiperidin-1-yl)-3-methyl-1H-pyrimidine-2,4-dione;dihydrochloride. InChIKey: PHDAWMGRCHKVKF-UHFFFAOYSA-N.
| Molecular formula | C10H18Cl2N4O2 |
|---|---|
| Molecular weight | 297.18 g/mol |
| IUPAC name | 6-(4-aminopiperidin-1-yl)-3-methyl-1H-pyrimidine-2,4-dione;dihydrochloride |
| InChIKey | PHDAWMGRCHKVKF-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C=C(NC1=O)N2CCC(CC2)N.Cl.Cl |
Computed by PubChem (NCBI)