Products 2172097-20-8
CAS 2172097-20-8 is the registry number for tert-Butyl N-((5-oxo-5,6,7,8-tetrahydronaphthalen-2-yl)methyl)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl N-[(5-oxo-7,8-dihydro-6H-naphthalen-2-yl)methyl]carbamate (CAS 2172097-20-8) is a chemical compound with the molecular formula C16H21NO3 and a molecular weight of 275.34 g/mol. IUPAC name: tert-butyl N-[(5-oxo-7,8-dihydro-6H-naphthalen-2-yl)methyl]carbamate. InChIKey: UXHXLQQXSWAGPW-UHFFFAOYSA-N.
| Molecular formula | C16H21NO3 |
|---|---|
| Molecular weight | 275.34 g/mol |
| IUPAC name | tert-butyl N-[(5-oxo-7,8-dihydro-6H-naphthalen-2-yl)methyl]carbamate |
| InChIKey | UXHXLQQXSWAGPW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC2=C(C=C1)C(=O)CCC2 |
Computed by PubChem (NCBI)