CAS 2172603-61-9 is the registry number for (5-(Trifluoromethyl)-1H-imidazol-2-yl)methanol hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
[5-(trifluoromethyl)-1H-imidazol-2-yl]methanol;hydrochloride (CAS 2172603-61-9) is a chemical compound with the molecular formula C5H6ClF3N2O and a molecular weight of 202.56 g/mol. IUPAC name: [5-(trifluoromethyl)-1H-imidazol-2-yl]methanol;hydrochloride. InChIKey: LINMNOYZAFXZMP-UHFFFAOYSA-N.
| Molecular formula | C5H6ClF3N2O |
|---|---|
| Molecular weight | 202.56 g/mol |
| IUPAC name | [5-(trifluoromethyl)-1H-imidazol-2-yl]methanol;hydrochloride |
| InChIKey | LINMNOYZAFXZMP-UHFFFAOYSA-N |
| SMILES | C1=C(NC(=N1)CO)C(F)(F)F.Cl |
Computed by PubChem (NCBI)