CAS 2260936-78-3 is the registry number for (5-(Trifluoromethyl)oxazol-4-yl)methanamine hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g.
[5-(trifluoromethyl)-1,3-oxazol-4-yl]methanamine;hydrochloride (CAS 2260936-78-3) is a chemical compound with the molecular formula C5H6ClF3N2O and a molecular weight of 202.56 g/mol. IUPAC name: [5-(trifluoromethyl)-1,3-oxazol-4-yl]methanamine;hydrochloride. InChIKey: KOJGWQSRVPFRJV-UHFFFAOYSA-N.
| Molecular formula | C5H6ClF3N2O |
|---|---|
| Molecular weight | 202.56 g/mol |
| IUPAC name | [5-(trifluoromethyl)-1,3-oxazol-4-yl]methanamine;hydrochloride |
| InChIKey | KOJGWQSRVPFRJV-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(O1)C(F)(F)F)CN.Cl |
Computed by PubChem (NCBI)