CAS 2172942-15-1 is the registry number for tert-Butyl (S)-4-(3-amino-2,5-dimethylbenzyl)-2-methylpiperazine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2S)-4-[(3-amino-2,5-dimethylphenyl)methyl]-2-methylpiperazine-1-carboxylate (CAS 2172942-15-1) is a chemical compound with the molecular formula C19H31N3O2 and a molecular weight of 333.5 g/mol. IUPAC name: tert-butyl (2S)-4-[(3-amino-2,5-dimethylphenyl)methyl]-2-methylpiperazine-1-carboxylate. InChIKey: ZMUIKCYQEZXDDD-AWEZNQCLSA-N.
| Molecular formula | C19H31N3O2 |
|---|---|
| Molecular weight | 333.5 g/mol |
| IUPAC name | tert-butyl (2S)-4-[(3-amino-2,5-dimethylphenyl)methyl]-2-methylpiperazine-1-carboxylate |
| InChIKey | ZMUIKCYQEZXDDD-AWEZNQCLSA-N |
| SMILES | C[C@H]1CN(CCN1C(=O)OC(C)(C)C)CC2=C(C(=CC(=C2)C)N)C |
Computed by PubChem (NCBI)