CAS 282726-22-1 appears in our catalog under these names: N-Et-Val-Leu-anilide, N–Et–Val–Leu–anilide. Offered by: TRC, GLPBio, Biosynth. Available pack sizes: 250mg, 50mg, 25mg, 100mg.
(2S)-2-[[(2S)-2-(ethylamino)-3-methylbutanoyl]amino]-4-methyl-N-phenylpentanamide (CAS 282726-22-1) is a chemical compound with the molecular formula C19H31N3O2 and a molecular weight of 333.5 g/mol. IUPAC name: (2S)-2-[[(2S)-2-(ethylamino)-3-methylbutanoyl]amino]-4-methyl-N-phenylpentanamide. InChIKey: DQZGJLPYZMBYQZ-IRXDYDNUSA-N.
| Molecular formula | C19H31N3O2 |
|---|---|
| Molecular weight | 333.5 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-(ethylamino)-3-methylbutanoyl]amino]-4-methyl-N-phenylpentanamide |
| InChIKey | DQZGJLPYZMBYQZ-IRXDYDNUSA-N |
| SMILES | CCN[C@@H](C(C)C)C(=O)N[C@@H](CC(C)C)C(=O)NC1=CC=CC=C1 |
Computed by PubChem (NCBI)