CAS 2173052-96-3 is the registry number for N-[(2S,4R)-2-(3-Aminophenyl)tetrahydro-2h-pyran-4-yl]acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-[(2S,4R)-2-(3-aminophenyl)oxan-4-yl]acetamide (CAS 2173052-96-3) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: N-[(2S,4R)-2-(3-aminophenyl)oxan-4-yl]acetamide. InChIKey: TVMAYZNRNBCRMV-OLZOCXBDSA-N.
| Molecular formula | C13H18N2O2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | N-[(2S,4R)-2-(3-aminophenyl)oxan-4-yl]acetamide |
| InChIKey | TVMAYZNRNBCRMV-OLZOCXBDSA-N |
| SMILES | CC(=O)N[C@@H]1CCO[C@@H](C1)C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)