Products 2173098-79-6
CAS 2173098-79-6 is the registry number for 4-Bromo-2,6-diisopropylphenyl acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
[4-bromo-2,6-di(propan-2-yl)phenyl] acetate (CAS 2173098-79-6) is a chemical compound with the molecular formula C14H19BrO2 and a molecular weight of 299.20 g/mol. IUPAC name: [4-bromo-2,6-di(propan-2-yl)phenyl] acetate. InChIKey: HIIWQWFHDXSDEL-UHFFFAOYSA-N.
| Molecular formula | C14H19BrO2 |
|---|---|
| Molecular weight | 299.20 g/mol |
| IUPAC name | [4-bromo-2,6-di(propan-2-yl)phenyl] acetate |
| InChIKey | HIIWQWFHDXSDEL-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1OC(=O)C)C(C)C)Br |
Computed by PubChem (NCBI)