Products 2217002-28-1
CAS 2217002-28-1 is the registry number for 3-Bromo-5-(tert-butyl)-2-isopropoxybenzaldehyde, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
3-bromo-5-tert-butyl-2-propan-2-yloxybenzaldehyde (CAS 2217002-28-1) is a chemical compound with the molecular formula C14H19BrO2 and a molecular weight of 299.20 g/mol. IUPAC name: 3-bromo-5-tert-butyl-2-propan-2-yloxybenzaldehyde. InChIKey: YGBKBAWHGCBEJV-UHFFFAOYSA-N.
| Molecular formula | C14H19BrO2 |
|---|---|
| Molecular weight | 299.20 g/mol |
| IUPAC name | 3-bromo-5-tert-butyl-2-propan-2-yloxybenzaldehyde |
| InChIKey | YGBKBAWHGCBEJV-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1Br)C(C)(C)C)C=O |
Computed by PubChem (NCBI)