Products 56913-88-3
CAS 56913-88-3 is the registry number for ((4-nitrophenyl)amino)((3-pyridylmethyl)amino)methane-1-thione. Offered by: Biosynth. Available pack sizes: 250mg.
1-(4-nitrophenyl)-3-(pyridin-3-ylmethyl)thiourea (CAS 56913-88-3) is a chemical compound with the molecular formula C13H12N4O2S and a molecular weight of 288.33 g/mol. IUPAC name: 1-(4-nitrophenyl)-3-(pyridin-3-ylmethyl)thiourea. InChIKey: AWLYIFHQUPAEEM-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O2S |
|---|---|
| Molecular weight | 288.33 g/mol |
| IUPAC name | 1-(4-nitrophenyl)-3-(pyridin-3-ylmethyl)thiourea |
| InChIKey | AWLYIFHQUPAEEM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)CNC(=S)NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)