Products 2173193-79-6
CAS 2173193-79-6 appears in our catalog under these names: Benzyl (S)-5-Amino-3，3-Dimethylpiperidine-1-Carboxylate Hydrochloride, 98%, 98%, Benzyl (S)-5-amino-3,3-dimethylpiperidine-1-carboxylate hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 250mg.
Benzyl (5S)-5-amino-3,3-dimethylpiperidine-1-carboxylate;hydrochloride (CAS 2173193-79-6) is a chemical compound with the molecular formula C15H23ClN2O2 and a molecular weight of 298.81 g/mol. IUPAC name: benzyl (5S)-5-amino-3,3-dimethylpiperidine-1-carboxylate;hydrochloride. InChIKey: QRDDCTHIEJIRSO-ZOWNYOTGSA-N.
| Molecular formula | C15H23ClN2O2 |
|---|---|
| Molecular weight | 298.81 g/mol |
| IUPAC name | benzyl (5S)-5-amino-3,3-dimethylpiperidine-1-carboxylate;hydrochloride |
| InChIKey | QRDDCTHIEJIRSO-ZOWNYOTGSA-N |
| SMILES | CC1(C[C@@H](CN(C1)C(=O)OCC2=CC=CC=C2)N)C.Cl |
Computed by PubChem (NCBI)