Products 2173253-15-9
CAS 2173253-15-9 is the registry number for 4-(4-(Trifluoromethyl)phenyl)-1,3,4,5-tetrahydro-2H-benzo[b][1,4]diazepin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-(trifluoromethyl)phenyl]-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one (CAS 2173253-15-9) is a chemical compound with the molecular formula C16H13F3N2O and a molecular weight of 306.28 g/mol. IUPAC name: 2-[4-(trifluoromethyl)phenyl]-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one. InChIKey: ZSAVWCDIFBFLEJ-UHFFFAOYSA-N.
| Molecular formula | C16H13F3N2O |
|---|---|
| Molecular weight | 306.28 g/mol |
| IUPAC name | 2-[4-(trifluoromethyl)phenyl]-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one |
| InChIKey | ZSAVWCDIFBFLEJ-UHFFFAOYSA-N |
| SMILES | C1C(NC2=CC=CC=C2NC1=O)C3=CC=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)