CAS 3086460-57-0 is the registry number for Neuroprotective agent 14. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-methyl-6-[[4-(trifluoromethyl)phenyl]methoxy]-1H-benzimidazole (CAS 3086460-57-0) is a chemical compound with the molecular formula C16H13F3N2O and a molecular weight of 306.28 g/mol. IUPAC name: 2-methyl-6-[[4-(trifluoromethyl)phenyl]methoxy]-1H-benzimidazole. InChIKey: GPJNRYXMQMLJLE-UHFFFAOYSA-N.
| Molecular formula | C16H13F3N2O |
|---|---|
| Molecular weight | 306.28 g/mol |
| IUPAC name | 2-methyl-6-[[4-(trifluoromethyl)phenyl]methoxy]-1H-benzimidazole |
| InChIKey | GPJNRYXMQMLJLE-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1)C=C(C=C2)OCC3=CC=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)