Products 2173375-10-3
CAS 2173375-10-3 is the registry number for Kv3 modulator 4. Offered by: Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 25mg, Get quote.
5,5-dimethyl-3-[3-(7-methylspiro[2H-1-benzofuran-3,1'-cyclopropane]-4-yl)oxycyclobutyl]imidazolidine-2,4-dione (CAS 2173375-10-3) is a chemical compound with the molecular formula C20H24N2O4 and a molecular weight of 356.4 g/mol. IUPAC name: 5,5-dimethyl-3-[3-(7-methylspiro[2H-1-benzofuran-3,1'-cyclopropane]-4-yl)oxycyclobutyl]imidazolidine-2,4-dione. InChIKey: VHINDDIFNPLNFD-UHFFFAOYSA-N.
| Molecular formula | C20H24N2O4 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 5,5-dimethyl-3-[3-(7-methylspiro[2H-1-benzofuran-3,1'-cyclopropane]-4-yl)oxycyclobutyl]imidazolidine-2,4-dione |
| InChIKey | VHINDDIFNPLNFD-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)OC3CC(C3)N4C(=O)C(NC4=O)(C)C)C5(CC5)CO2 |
Computed by PubChem (NCBI)
Synonyms:
Kv3 modulator 4, orb1709306