CAS 2173637-05-1 is the registry number for tert-Butyl ((3S,4S)-4-hydroxypyrrolidin-3-yl)carbamate hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 5g, 100mg, 10g.
Tert-butyl N-[(3S,4S)-4-hydroxypyrrolidin-3-yl]carbamate;hydrochloride (CAS 2173637-05-1) is a chemical compound with the molecular formula C9H19ClN2O3 and a molecular weight of 238.71 g/mol. IUPAC name: tert-butyl N-[(3S,4S)-4-hydroxypyrrolidin-3-yl]carbamate;hydrochloride. InChIKey: UYFVSDFSFICTSZ-LEUCUCNGSA-N.
| Molecular formula | C9H19ClN2O3 |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | tert-butyl N-[(3S,4S)-4-hydroxypyrrolidin-3-yl]carbamate;hydrochloride |
| InChIKey | UYFVSDFSFICTSZ-LEUCUCNGSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CNC[C@@H]1O.Cl |
Computed by PubChem (NCBI)